C13H15FN2O2 — CID 90808912
3-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide (PubChem CID 90808912) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide.
| Compound Name | 3-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 90808912 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide |
| SMILES | CC1(C)C(c2ccc(F)cc2)C1(C(N)=O)C(N)=O |
| InChI | InChI=1S/C13H15FN2O2/c1-12(2)9(7-3-5-8(14)6-4-7)13(12,10(15)17)11(16)18/h3-6,9H,1-2H3,(H2,15,17)(H2,16,18) |
| InChIKey | ATDQFKTUOGRPIV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|