C19H28O — CID 101056644
(3aR,5aR,10aR)-3a,5a-dimethyl-1-propan-2-yl-3,4,5,9,10,10a-hexahydro-2H-cyclohepta[e]inden-6-one (PubChem CID 101056644) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (3aR,5aR,10aR)-3a,5a-dimethyl-1-propan-2-yl-3,4,5,9,10,10a-hexahydro-2H-cyclohepta[e]inden-6-one.
| Compound Name | (3aR,5aR,10aR)-3a,5a-dimethyl-1-propan-2-yl-3,4,5,9,10,10a-hexahydro-2H-cyclohepta[e]inden-6-one |
|---|---|
| PubChem CID | 101056644 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (3aR,5aR,10aR)-3a,5a-dimethyl-1-propan-2-yl-3,4,5,9,10,10a-hexahydro-2H-cyclohepta[e]inden-6-one |
| SMILES | CC(C)C1=C2[C@H]3CCC=CC(=O)[C@]3(C)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C19H28O/c1-13(2)14-9-10-18(3)11-12-19(4)15(17(14)18)7-5-6-8-16(19)20/h6,8,13,15H,5,7,9-12H2,1-4H3/t15-,18-,19-/m1/s1 |
| InChIKey | UIYDPLYHOYJNHF-ATZDWAIDSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|