C26H36O3 — CID 11486292
(3aR,5aR,9aR)-1-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3a,5a-dimethyl-2,3,4,5,7,8,9,9a-octahydrocyclopenta[a]naphthalen-6-one (PubChem CID 11486292) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is (3aR,5aR,9aR)-1-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3a,5a-dimethyl-2,3,4,5,7,8,9,9a-octahydrocyclopenta[a]naphthalen-6-one.
| Compound Name | (3aR,5aR,9aR)-1-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3a,5a-dimethyl-2,3,4,5,7,8,9,9a-octahydrocyclopenta[a]naphthalen-6-one |
|---|---|
| PubChem CID | 11486292 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (3aR,5aR,9aR)-1-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3a,5a-dimethyl-2,3,4,5,7,8,9,9a-octahydrocyclopenta[a]naphthalen-6-one |
| SMILES | COc1ccc(COC[C@@H](C)C2=C3[C@H]4CCCC(=O)[C@]4(C)CC[C@@]3(C)CC2)cc1 |
| InChI | InChI=1S/C26H36O3/c1-18(16-29-17-19-8-10-20(28-4)11-9-19)21-12-13-25(2)14-15-26(3)22(24(21)25)6-5-7-23(26)27/h8-11,18,22H,5-7,12-17H2,1-4H3/t18-,22-,25-,26-/m1/s1 |
| InChIKey | LKJMHUXAXVFFSJ-SAHUUAETSA-N |
| XLogP | 6.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|