C20H27NO2 — CID 91096666
(3aS,5aR,10aR)-8-formyl-5a-methyl-6-oxo-1-propan-2-yl-3,4,5,7,8,9,10,10a-octahydro-2H-cyclohepta[g]indene-3a-carbonitrile (PubChem CID 91096666) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (3aS,5aR,10aR)-8-formyl-5a-methyl-6-oxo-1-propan-2-yl-3,4,5,7,8,9,10,10a-octahydro-2H-cyclohepta[g]indene-3a-carbonitrile.
| Compound Name | (3aS,5aR,10aR)-8-formyl-5a-methyl-6-oxo-1-propan-2-yl-3,4,5,7,8,9,10,10a-octahydro-2H-cyclohepta[g]indene-3a-carbonitrile |
|---|---|
| PubChem CID | 91096666 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (3aS,5aR,10aR)-8-formyl-5a-methyl-6-oxo-1-propan-2-yl-3,4,5,7,8,9,10,10a-octahydro-2H-cyclohepta[g]indene-3a-carbonitrile |
| SMILES | CC(C)C1=C2[C@H]3CCC(C=O)CC(=O)[C@]3(C)CC[C@@]2(C#N)CC1 |
| InChI | InChI=1S/C20H27NO2/c1-13(2)15-6-7-20(12-21)9-8-19(3)16(18(15)20)5-4-14(11-22)10-17(19)23/h11,13-14,16H,4-10H2,1-3H3/t14?,16-,19-,20-/m1/s1 |
| InChIKey | WINZCLRXWCBMHZ-VWZLZXLISA-N |
| XLogP | 4.23 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|