C19H29BrO2 — CID 134942349
(5S,7aR)-4-(2-bromo-1-methoxyethyl)-7a-methyl-3-propan-2-ylspiro[2,4,6,7-tetrahydro-1H-indene-5,2'-cyclobutane]-1'-one (PubChem CID 134942349) has the molecular formula C19H29BrO2 and a molecular weight of 369.34 g/mol. Its IUPAC name is (5S,7aR)-4-(2-bromo-1-methoxyethyl)-7a-methyl-3-propan-2-ylspiro[2,4,6,7-tetrahydro-1H-indene-5,2'-cyclobutane]-1'-one.
| Compound Name | (5S,7aR)-4-(2-bromo-1-methoxyethyl)-7a-methyl-3-propan-2-ylspiro[2,4,6,7-tetrahydro-1H-indene-5,2'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 134942349 |
| Molecular Formula | C19H29BrO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (5S,7aR)-4-(2-bromo-1-methoxyethyl)-7a-methyl-3-propan-2-ylspiro[2,4,6,7-tetrahydro-1H-indene-5,2'-cyclobutane]-1'-one |
| SMILES | COC(CBr)C1C2=C(C(C)C)CC[C@]2(C)CC[C@]12CCC2=O |
| InChI | InChI=1S/C19H29BrO2/c1-12(2)13-5-7-18(3)9-10-19(8-6-15(19)21)17(16(13)18)14(11-20)22-4/h12,14,17H,5-11H2,1-4H3/t14?,17?,18-,19+/m1/s1 |
| InChIKey | BUQGKTGDBGNLHP-CTVCJKGISA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|