C19H28O7 — CID 101058554
(2R,3R,4S,5R,6R)-2-[(1R,2R)-2-hydroxycyclohexyl]oxy-6-(phenylmethoxymethyl)oxane-3,4,5-triol (PubChem CID 101058554) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[(1R,2R)-2-hydroxycyclohexyl]oxy-6-(phenylmethoxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[(1R,2R)-2-hydroxycyclohexyl]oxy-6-(phenylmethoxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 101058554 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[(1R,2R)-2-hydroxycyclohexyl]oxy-6-(phenylmethoxymethyl)oxane-3,4,5-triol |
| SMILES | O[C@H]1[C@@H](O)[C@@H](COCc2ccccc2)O[C@@H](O[C@@H]2CCCC[C@H]2O)[C@@H]1O |
| InChI | InChI=1S/C19H28O7/c20-13-8-4-5-9-14(13)25-19-18(23)17(22)16(21)15(26-19)11-24-10-12-6-2-1-3-7-12/h1-3,6-7,13-23H,4-5,8-11H2/t13-,14-,15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | JDLGLOGNBUBMDI-NPAXRPIGSA-N |
| XLogP | 0.33 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |