C12H14N2O4 — CID 101059207
methyl 2-[[4-(2-methoxy-2-oxoethyl)iminocyclohexa-2,5-dien-1-ylidene]amino]acetate (PubChem CID 101059207) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl 2-[[4-(2-methoxy-2-oxoethyl)iminocyclohexa-2,5-dien-1-ylidene]amino]acetate.
| Compound Name | methyl 2-[[4-(2-methoxy-2-oxoethyl)iminocyclohexa-2,5-dien-1-ylidene]amino]acetate |
|---|---|
| PubChem CID | 101059207 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | methyl 2-[[4-(2-methoxy-2-oxoethyl)iminocyclohexa-2,5-dien-1-ylidene]amino]acetate |
| SMILES | COC(=O)CN=C1C=CC(=NCC(=O)OC)C=C1 |
| InChI | InChI=1S/C12H14N2O4/c1-17-11(15)7-13-9-3-5-10(6-4-9)14-8-12(16)18-2/h3-6H,7-8H2,1-2H3/b13-9-,14-10+ |
| InChIKey | PWSVZQUCHBSUBG-ZKLMZBBOSA-N |
| XLogP | 0.34 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|