C18H24N2O3 — CID 118132037
methyl 2-[[3-(4-methoxyanilino)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]acetate (PubChem CID 118132037) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 2-[[3-(4-methoxyanilino)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]acetate.
| Compound Name | methyl 2-[[3-(4-methoxyanilino)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]acetate |
|---|---|
| PubChem CID | 118132037 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | methyl 2-[[3-(4-methoxyanilino)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]acetate |
| SMILES | COC(=O)C/N=C1/C=C(Nc2ccc(OC)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C18H24N2O3/c1-18(2)10-14(19-12-17(21)23-4)9-15(11-18)20-13-5-7-16(22-3)8-6-13/h5-9,20H,10-12H2,1-4H3/b19-14- |
| InChIKey | YZFCODXRBHVNAE-RGEXLXHISA-N |
| XLogP | 3.42 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|