C20H13Cl2N3O4 — CID 101064405
7-[[6-amino-4-(3,5-dichloroanilino)-2-pyridinyl]oxy]-4-hydroxychromen-2-one (PubChem CID 101064405) has the molecular formula C20H13Cl2N3O4 and a molecular weight of 430.25 g/mol. Its IUPAC name is 7-[[6-amino-4-(3,5-dichloroanilino)-2-pyridinyl]oxy]-4-hydroxychromen-2-one.
| Compound Name | 7-[[6-amino-4-(3,5-dichloroanilino)-2-pyridinyl]oxy]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 101064405 |
| Molecular Formula | C20H13Cl2N3O4 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 7-[[6-amino-4-(3,5-dichloroanilino)-2-pyridinyl]oxy]-4-hydroxychromen-2-one |
| SMILES | Nc1cc(Nc2cc(Cl)cc(Cl)c2)cc(Oc2ccc3c(O)cc(=O)oc3c2)n1 |
| InChI | InChI=1S/C20H13Cl2N3O4/c21-10-3-11(22)5-12(4-10)24-13-6-18(23)25-19(7-13)28-14-1-2-15-16(26)9-20(27)29-17(15)8-14/h1-9,26H,(H3,23,24,25) |
| InChIKey | JWOVGACYQFUYTA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|