C20H18OS — CID 101065560
(1S,5R,7S)-7-benzyl-7-phenylsulfanylbicyclo[3.2.0]hept-2-en-6-one (PubChem CID 101065560) has the molecular formula C20H18OS and a molecular weight of 306.43 g/mol. Its IUPAC name is (1S,5R,7S)-7-benzyl-7-phenylsulfanylbicyclo[3.2.0]hept-2-en-6-one.
| Compound Name | (1S,5R,7S)-7-benzyl-7-phenylsulfanylbicyclo[3.2.0]hept-2-en-6-one |
|---|---|
| PubChem CID | 101065560 |
| Molecular Formula | C20H18OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (1S,5R,7S)-7-benzyl-7-phenylsulfanylbicyclo[3.2.0]hept-2-en-6-one |
| SMILES | O=C1[C@@H]2CC=C[C@@H]2[C@]1(Cc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C20H18OS/c21-19-17-12-7-13-18(17)20(19,14-15-8-3-1-4-9-15)22-16-10-5-2-6-11-16/h1-11,13,17-18H,12,14H2/t17-,18+,20+/m1/s1 |
| InChIKey | RISXONBJQUPDBU-HBFSDRIKSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|