C21H18N4O9S2 — CID 101068252
2-[carboxy-[(2-thiophen-2-ylacetyl)amino]methyl]-5-[(E)-2-(2,4-dinitrophenyl)ethenyl]-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid (PubChem CID 101068252) has the molecular formula C21H18N4O9S2 and a molecular weight of 534.53 g/mol. Its IUPAC name is 2-[carboxy-[(2-thiophen-2-ylacetyl)amino]methyl]-5-[(E)-2-(2,4-dinitrophenyl)ethenyl]-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid.
| Compound Name | 2-[carboxy-[(2-thiophen-2-ylacetyl)amino]methyl]-5-[(E)-2-(2,4-dinitrophenyl)ethenyl]-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid |
|---|---|
| PubChem CID | 101068252 |
| Molecular Formula | C21H18N4O9S2 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | 2-[carboxy-[(2-thiophen-2-ylacetyl)amino]methyl]-5-[(E)-2-(2,4-dinitrophenyl)ethenyl]-3,6-dihydro-2H-1,3-thiazine-4-carboxylic acid |
| SMILES | O=C(Cc1cccs1)NC(C(=O)O)C1NC(C(=O)O)=C(/C=C/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CS1 |
| InChI | InChI=1S/C21H18N4O9S2/c26-16(9-14-2-1-7-35-14)22-18(21(29)30)19-23-17(20(27)28)12(10-36-19)4-3-11-5-6-13(24(31)32)8-15(11)25(33)34/h1-8,18-19,23H,9-10H2,(H,22,26)(H,27,28)(H,29,30)/b4-3+ |
| InChIKey | PYBZXZZHQKFSGC-ONEGZZNKSA-N |
| XLogP | 2.39 |
| TPSA | 202.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|