C37H48N3O5P — CID 101073457
N-[[4-[[4-(diethylaminomethyl)phenyl]-[[(1R,3R,7R,8R,9R)-5-methyl-11-phenyl-2,4,10,12-tetraoxa-6-azatricyclo[7.4.0.03,7]tridec-5-en-8-yl]oxy]phosphanyl]phenyl]methyl]-N-ethylethanamine (PubChem CID 101073457) has the molecular formula C37H48N3O5P and a molecular weight of 645.78 g/mol. Its IUPAC name is N-[[4-[[4-(diethylaminomethyl)phenyl]-[[(1R,3R,7R,8R,9R)-5-methyl-11-phenyl-2,4,10,12-tetraoxa-6-azatricyclo[7.4.0.03,7]tridec-5-en-8-yl]oxy]phosphanyl]phenyl]methyl]-N-ethylethanamine.
| Compound Name | N-[[4-[[4-(diethylaminomethyl)phenyl]-[[(1R,3R,7R,8R,9R)-5-methyl-11-phenyl-2,4,10,12-tetraoxa-6-azatricyclo[7.4.0.03,7]tridec-5-en-8-yl]oxy]phosphanyl]phenyl]methyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 101073457 |
| Molecular Formula | C37H48N3O5P |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | N-[[4-[[4-(diethylaminomethyl)phenyl]-[[(1R,3R,7R,8R,9R)-5-methyl-11-phenyl-2,4,10,12-tetraoxa-6-azatricyclo[7.4.0.03,7]tridec-5-en-8-yl]oxy]phosphanyl]phenyl]methyl]-N-ethylethanamine |
| SMILES | CCN(CC)Cc1ccc(P(O[C@@H]2[C@H]3N=C(C)O[C@H]3O[C@@H]3COC(c4ccccc4)O[C@@H]23)c2ccc(CN(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C37H48N3O5P/c1-6-39(7-2)23-27-15-19-30(20-16-27)46(31-21-17-28(18-22-31)24-40(8-3)9-4)45-35-33-37(42-26(5)38-33)43-32-25-41-36(44-34(32)35)29-13-11-10-12-14-29/h10-22,32-37H,6-9,23-25H2,1-5H3/t32-,33-,34-,35-,36?,37+/m1/s1 |
| InChIKey | LXSCPFCDGOQRKN-RUPULIPWSA-N |
| XLogP | 5.76 |
| TPSA | 64.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|