C17H20N2OS2 — CID 101073558
1,3-bis[[4-(sulfanylmethyl)phenyl]methyl]urea (PubChem CID 101073558) has the molecular formula C17H20N2OS2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1,3-bis[[4-(sulfanylmethyl)phenyl]methyl]urea.
| Compound Name | 1,3-bis[[4-(sulfanylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 101073558 |
| Molecular Formula | C17H20N2OS2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1,3-bis[[4-(sulfanylmethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(CS)cc1)NCc1ccc(CS)cc1 |
| InChI | InChI=1S/C17H20N2OS2/c20-17(18-9-13-1-5-15(11-21)6-2-13)19-10-14-3-7-16(12-22)8-4-14/h1-8,21-22H,9-12H2,(H2,18,19,20) |
| InChIKey | TVFVDWZZYMBTII-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|