C13H20O3 — CID 101073829
(6S,6aR)-6-(ethoxymethoxy)-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one (PubChem CID 101073829) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (6S,6aR)-6-(ethoxymethoxy)-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one.
| Compound Name | (6S,6aR)-6-(ethoxymethoxy)-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one |
|---|---|
| PubChem CID | 101073829 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (6S,6aR)-6-(ethoxymethoxy)-5,5-dimethyl-1,4,6,6a-tetrahydropentalen-2-one |
| SMILES | CCOCO[C@H]1[C@@H]2CC(=O)C=C2CC1(C)C |
| InChI | InChI=1S/C13H20O3/c1-4-15-8-16-12-11-6-10(14)5-9(11)7-13(12,2)3/h5,11-12H,4,6-8H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | JZIUUMUGHBXUSI-NEPJUHHUSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|