C15H18O7 — CID 101074715
(4R)-4-[(S)-(6-methoxy-1,3-benzodioxol-5-yl)-(methoxymethoxy)methyl]oxolan-2-one (PubChem CID 101074715) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is (4R)-4-[(S)-(6-methoxy-1,3-benzodioxol-5-yl)-(methoxymethoxy)methyl]oxolan-2-one.
| Compound Name | (4R)-4-[(S)-(6-methoxy-1,3-benzodioxol-5-yl)-(methoxymethoxy)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 101074715 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (4R)-4-[(S)-(6-methoxy-1,3-benzodioxol-5-yl)-(methoxymethoxy)methyl]oxolan-2-one |
| SMILES | COCO[C@H](c1cc2c(cc1OC)OCO2)[C@H]1COC(=O)C1 |
| InChI | InChI=1S/C15H18O7/c1-17-7-22-15(9-3-14(16)19-6-9)10-4-12-13(21-8-20-12)5-11(10)18-2/h4-5,9,15H,3,6-8H2,1-2H3/t9-,15+/m1/s1 |
| InChIKey | ACSPMUAUASLOSQ-PSLIRLAXSA-N |
| XLogP | 1.65 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|