C8H18N2S — CID 101075992
3-N,3-N,4-N,4-N-tetramethylthiolane-3,4-diamine (PubChem CID 101075992) has the molecular formula C8H18N2S and a molecular weight of 174.31 g/mol. Its IUPAC name is 3-N,3-N,4-N,4-N-tetramethylthiolane-3,4-diamine.
| Compound Name | 3-N,3-N,4-N,4-N-tetramethylthiolane-3,4-diamine |
|---|---|
| PubChem CID | 101075992 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3-N,3-N,4-N,4-N-tetramethylthiolane-3,4-diamine |
| SMILES | CN(C)C1CSCC1N(C)C |
| InChI | InChI=1S/C8H18N2S/c1-9(2)7-5-11-6-8(7)10(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | FTXUPTWNROUKFY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |