C27H24N2O2S — CID 101076866
(3aR,4S,9bS)-4-[1-(benzenesulfonyl)indol-3-yl]-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 101076866) has the molecular formula C27H24N2O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-[1-(benzenesulfonyl)indol-3-yl]-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bS)-4-[1-(benzenesulfonyl)indol-3-yl]-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 101076866 |
| Molecular Formula | C27H24N2O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (3aR,4S,9bS)-4-[1-(benzenesulfonyl)indol-3-yl]-8-methyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1ccc2c(c1)[C@H]1C=CC[C@H]1[C@@H](c1cn(S(=O)(=O)c3ccccc3)c3ccccc13)N2 |
| InChI | InChI=1S/C27H24N2O2S/c1-18-14-15-25-23(16-18)20-11-7-12-22(20)27(28-25)24-17-29(26-13-6-5-10-21(24)26)32(30,31)19-8-3-2-4-9-19/h2-11,13-17,20,22,27-28H,12H2,1H3/t20-,22+,27-/m0/s1 |
| InChIKey | DBSKTNQPFKGELI-ZIHSNCGMSA-N |
| XLogP | 6.01 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|