C20H20N2O3S — CID 101077252
4-[2-(3-methylbutylsulfanyl)-4-oxoquinazolin-3-yl]benzoic acid (PubChem CID 101077252) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-[2-(3-methylbutylsulfanyl)-4-oxoquinazolin-3-yl]benzoic acid.
| Compound Name | 4-[2-(3-methylbutylsulfanyl)-4-oxoquinazolin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 101077252 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-[2-(3-methylbutylsulfanyl)-4-oxoquinazolin-3-yl]benzoic acid |
| SMILES | CC(C)CCSc1nc2ccccc2c(=O)n1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-13(2)11-12-26-20-21-17-6-4-3-5-16(17)18(23)22(20)15-9-7-14(8-10-15)19(24)25/h3-10,13H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | UYSGHNBFUTZBCP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |