About methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate
methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate (PubChem CID 101078310) has the molecular formula C32H26O3
and a molecular weight of 458.56 g/mol. Its IUPAC name is methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate |
| PubChem CID | 101078310 |
| Molecular Formula | C32H26O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate |
| SMILES | COC(=O)C(=C(c1ccccc1)c1ccccc1)C1=C(c2ccccc2)c2ccccc2C1OC |
| InChI | InChI=1S/C32H26O3/c1-34-31-26-21-13-12-20-25(26)28(24-18-10-5-11-19-24)29(31)30(32(33)35-2)27(22-14-6-3-7-15-22)23-16-8-4-9-17-23/h3-21,31H,1-2H3 |
| InChIKey | DBUKNBQWQGDHTN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate?
The IUPAC name of methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate (CID 101078310) is methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate.
What is the SMILES notation for methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate?
The canonical SMILES for methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate is COC(=O)C(=C(c1ccccc1)c1ccccc1)C1=C(c2ccccc2)c2ccccc2C1OC.
What is the InChIKey of methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate?
The InChIKey is DBUKNBQWQGDHTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H26O3/c1-34-31-26-21-13-12-20-25(26)28(24-18-10-5-11-19-24)29(31)30(32(33)35-2)27(22-14-6-3-7-15-22)23-16-8-4-9-17-23/h3-21,31H,1-2H3.
What are the key properties of methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate?
methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate has a molecular weight of 458.56 g/mol, XLogP of 6.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate is sourced from PubChem (CID 101078310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).