C32H26O3 — CID 101078310
methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate (PubChem CID 101078310) has the molecular formula C32H26O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate.
| Compound Name | methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 101078310 |
| Molecular Formula | C32H26O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | methyl 2-(1-methoxy-3-phenyl-1H-inden-2-yl)-3,3-diphenylprop-2-enoate |
| SMILES | COC(=O)C(=C(c1ccccc1)c1ccccc1)C1=C(c2ccccc2)c2ccccc2C1OC |
| InChI | InChI=1S/C32H26O3/c1-34-31-26-21-13-12-20-25(26)28(24-18-10-5-11-19-24)29(31)30(32(33)35-2)27(22-14-6-3-7-15-22)23-16-8-4-9-17-23/h3-21,31H,1-2H3 |
| InChIKey | DBUKNBQWQGDHTN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|