C12H17N3O5 — CID 10107858
tert-butyl 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetate (PubChem CID 10107858) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is tert-butyl 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetate.
| Compound Name | tert-butyl 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 10107858 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | tert-butyl 2-[amino-[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(N)C(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17N3O5/c1-12(2,3)20-11(19)7-15(13)10(18)6-14-8(16)4-5-9(14)17/h4-5H,6-7,13H2,1-3H3 |
| InChIKey | UVDJYSSYRLLDBV-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|