C7H14N2O4 — CID 101080923
(2R)-2-[(2-aminoacetyl)amino]-2-hydroxy-3-methylbutanoic acid (PubChem CID 101080923) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is (2R)-2-[(2-aminoacetyl)amino]-2-hydroxy-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(2-aminoacetyl)amino]-2-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 101080923 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2R)-2-[(2-aminoacetyl)amino]-2-hydroxy-3-methylbutanoic acid |
| SMILES | CC(C)[C@](O)(NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C7H14N2O4/c1-4(2)7(13,6(11)12)9-5(10)3-8/h4,13H,3,8H2,1-2H3,(H,9,10)(H,11,12)/t7-/m1/s1 |
| InChIKey | FJJFRLARBNCSIY-SSDOTTSWSA-N |
| XLogP | -1.51 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|