C5H13N3O — CID 55290917
2-amino-N'-propan-2-ylacetohydrazide (PubChem CID 55290917) has the molecular formula C5H13N3O and a molecular weight of 131.18 g/mol. Its IUPAC name is 2-amino-N'-propan-2-ylacetohydrazide.
| Compound Name | 2-amino-N'-propan-2-ylacetohydrazide |
|---|---|
| PubChem CID | 55290917 |
| Molecular Formula | C5H13N3O |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | 2-amino-N'-propan-2-ylacetohydrazide |
| SMILES | CC(C)NNC(=O)CN |
| InChI | InChI=1S/C5H13N3O/c1-4(2)7-8-5(9)3-6/h4,7H,3,6H2,1-2H3,(H,8,9) |
| InChIKey | OOWFNAMSLMCBIQ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|