C7H12Cl2N2O4 — CID 142629289
ethyl 2-[(2-aminoacetyl)amino]-3,3-dichloro-2-hydroxypropanoate (PubChem CID 142629289) has the molecular formula C7H12Cl2N2O4 and a molecular weight of 259.09 g/mol. Its IUPAC name is ethyl 2-[(2-aminoacetyl)amino]-3,3-dichloro-2-hydroxypropanoate.
| Compound Name | ethyl 2-[(2-aminoacetyl)amino]-3,3-dichloro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 142629289 |
| Molecular Formula | C7H12Cl2N2O4 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | ethyl 2-[(2-aminoacetyl)amino]-3,3-dichloro-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(O)(NC(=O)CN)C(Cl)Cl |
| InChI | InChI=1S/C7H12Cl2N2O4/c1-2-15-6(13)7(14,5(8)9)11-4(12)3-10/h5,14H,2-3,10H2,1H3,(H,11,12) |
| InChIKey | RXVKXBROVRSBPL-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|