C15H12O6 — CID 10108140
2,4-dihydroxy-6-methoxy-13-methyl-12,14-dioxatetracyclo[8.5.0.03,8.011,13]pentadeca-1,3,5,7,9-pentaen-15-one (PubChem CID 10108140) has the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. Its IUPAC name is 2,4-dihydroxy-6-methoxy-13-methyl-12,14-dioxatetracyclo[8.5.0.03,8.011,13]pentadeca-1,3,5,7,9-pentaen-15-one.
| Compound Name | 2,4-dihydroxy-6-methoxy-13-methyl-12,14-dioxatetracyclo[8.5.0.03,8.011,13]pentadeca-1,3,5,7,9-pentaen-15-one |
|---|---|
| PubChem CID | 10108140 |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2,4-dihydroxy-6-methoxy-13-methyl-12,14-dioxatetracyclo[8.5.0.03,8.011,13]pentadeca-1,3,5,7,9-pentaen-15-one |
| SMILES | COc1cc(O)c2c(O)c3c(cc2c1)C1OC1(C)OC3=O |
| InChI | InChI=1S/C15H12O6/c1-15-13(20-15)8-4-6-3-7(19-2)5-9(16)10(6)12(17)11(8)14(18)21-15/h3-5,13,16-17H,1-2H3 |
| InChIKey | RDBSYBKFEBNIFQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|