C13H13N3 — CID 101081692
1,4-dimethyl-5H-pyrido[3,4-b]indol-3-amine (PubChem CID 101081692) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 1,4-dimethyl-5H-pyrido[3,4-b]indol-3-amine.
| Compound Name | 1,4-dimethyl-5H-pyrido[3,4-b]indol-3-amine |
|---|---|
| PubChem CID | 101081692 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1,4-dimethyl-5H-pyrido[3,4-b]indol-3-amine |
| SMILES | Cc1nc(N)c(C)c2c1=NC1=CC=CCC=21 |
| InChI | InChI=1S/C13H13N3/c1-7-11-9-5-3-4-6-10(9)16-12(11)8(2)15-13(7)14/h3-4,6H,5,14H2,1-2H3 |
| InChIKey | HSBQFNFZUOXKRZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |