C12H11N3 — CID 101206933
1-methyl-5H-pyrido[3,4-b]indol-3-amine (PubChem CID 101206933) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-methyl-5H-pyrido[3,4-b]indol-3-amine.
| Compound Name | 1-methyl-5H-pyrido[3,4-b]indol-3-amine |
|---|---|
| PubChem CID | 101206933 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-methyl-5H-pyrido[3,4-b]indol-3-amine |
| SMILES | Cc1nc(N)cc2c1=NC1=CC=CCC=21 |
| InChI | InChI=1S/C12H11N3/c1-7-12-9(6-11(13)14-7)8-4-2-3-5-10(8)15-12/h2-3,5-6H,4,13H2,1H3 |
| InChIKey | DSUTYTLSHDWNFS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |