C11H14N2 — CID 18459478
2,3,6-trimethylindol-6-amine (PubChem CID 18459478) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,3,6-trimethylindol-6-amine.
| Compound Name | 2,3,6-trimethylindol-6-amine |
|---|---|
| PubChem CID | 18459478 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,3,6-trimethylindol-6-amine |
| SMILES | CC1=NC2=CC(C)(N)C=CC2=C1C |
| InChI | InChI=1S/C11H14N2/c1-7-8(2)13-10-6-11(3,12)5-4-9(7)10/h4-6H,12H2,1-3H3 |
| InChIKey | XOVMMAWNQMPAGS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |