About 2,3,6-trimethylindol-6-amine
2,3,6-trimethylindol-6-amine (PubChem CID 18459478) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,3,6-trimethylindol-6-amine.
Molecular Properties
| Compound Name | 2,3,6-trimethylindol-6-amine |
| PubChem CID | 18459478 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,3,6-trimethylindol-6-amine |
| SMILES | CC1=NC2=CC(C)(N)C=CC2=C1C |
| InChI | InChI=1S/C11H14N2/c1-7-8(2)13-10-6-11(3,12)5-4-9(7)10/h4-6H,12H2,1-3H3 |
| InChIKey | XOVMMAWNQMPAGS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3,6-trimethylindol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trimethylindol-6-amine?
The IUPAC name of 2,3,6-trimethylindol-6-amine (CID 18459478) is 2,3,6-trimethylindol-6-amine.
What is the SMILES notation for 2,3,6-trimethylindol-6-amine?
The canonical SMILES for 2,3,6-trimethylindol-6-amine is CC1=NC2=CC(C)(N)C=CC2=C1C.
What is the InChIKey of 2,3,6-trimethylindol-6-amine?
The InChIKey is XOVMMAWNQMPAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-7-8(2)13-10-6-11(3,12)5-4-9(7)10/h4-6H,12H2,1-3H3.
What are the key properties of 2,3,6-trimethylindol-6-amine?
2,3,6-trimethylindol-6-amine has a molecular weight of 174.25 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trimethylindol-6-amine is sourced from PubChem (CID 18459478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).