C12H21F2O6P — CID 101082236
methyl (3R,4R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolane-3-carboxylate (PubChem CID 101082236) has the molecular formula C12H21F2O6P and a molecular weight of 330.26 g/mol. Its IUPAC name is methyl (3R,4R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolane-3-carboxylate.
| Compound Name | methyl (3R,4R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 101082236 |
| Molecular Formula | C12H21F2O6P |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl (3R,4R)-4-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolane-3-carboxylate |
| SMILES | CCOP(=O)(OCC)C(F)(F)C[C@H]1COC[C@@H]1C(=O)OC |
| InChI | InChI=1S/C12H21F2O6P/c1-4-19-21(16,20-5-2)12(13,14)6-9-7-18-8-10(9)11(15)17-3/h9-10H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | FKAVODMGJNUPHH-UWVGGRQHSA-N |
| XLogP | 2.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|