C10H19NO2S — CID 101085544
ethyl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 101085544) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is ethyl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | ethyl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 101085544 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | ethyl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CSC(CC)(CC)N1 |
| InChI | InChI=1S/C10H19NO2S/c1-4-10(5-2)11-8(7-14-10)9(12)13-6-3/h8,11H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | ZZYIACXGXCNDTE-QMMMGPOBSA-N |
| XLogP | 1.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |