C23H25N3O6 — CID 101088344
(2S,3S,4S,5S)-8-(azidomethyl)-3,4-bis(phenylmethoxy)-1,7-dioxaspiro[4.4]nonane-2-carboxylic acid (PubChem CID 101088344) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is (2S,3S,4S,5S)-8-(azidomethyl)-3,4-bis(phenylmethoxy)-1,7-dioxaspiro[4.4]nonane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-8-(azidomethyl)-3,4-bis(phenylmethoxy)-1,7-dioxaspiro[4.4]nonane-2-carboxylic acid |
|---|---|
| PubChem CID | 101088344 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2S,3S,4S,5S)-8-(azidomethyl)-3,4-bis(phenylmethoxy)-1,7-dioxaspiro[4.4]nonane-2-carboxylic acid |
| SMILES | [N-]=[N+]=NCC1C[C@@]2(CO1)O[C@H](C(=O)O)[C@@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C23H25N3O6/c24-26-25-12-18-11-23(15-31-18)21(30-14-17-9-5-2-6-10-17)19(20(32-23)22(27)28)29-13-16-7-3-1-4-8-16/h1-10,18-21H,11-15H2,(H,27,28)/t18?,19-,20+,21+,23+/m1/s1 |
| InChIKey | QWOBTJPTEPEGTJ-MPWPAPJSSA-N |
| XLogP | 3.48 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|