C18H32O4Si — CID 101088676
cis-(1R,2R)-2-[(Z)-6-ethoxy-6-oxo-5-(trimethylsilylmethyl)hex-4-enyl]cyclopentane-1-carboxylic acid (PubChem CID 101088676) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is cis-(1R,2R)-2-[(Z)-6-ethoxy-6-oxo-5-(trimethylsilylmethyl)hex-4-enyl]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,2R)-2-[(Z)-6-ethoxy-6-oxo-5-(trimethylsilylmethyl)hex-4-enyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 101088676 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | cis-(1R,2R)-2-[(Z)-6-ethoxy-6-oxo-5-(trimethylsilylmethyl)hex-4-enyl]cyclopentane-1-carboxylic acid |
| SMILES | CCOC(=O)/C(=C/CCC[C@@H]1CCC[C@H]1C(=O)O)C[Si](C)(C)C |
| InChI | InChI=1S/C18H32O4Si/c1-5-22-18(21)15(13-23(2,3)4)10-7-6-9-14-11-8-12-16(14)17(19)20/h10,14,16H,5-9,11-13H2,1-4H3,(H,19,20)/b15-10+/t14-,16-/m1/s1 |
| InChIKey | ZKCVNRVNWRFGAW-WYURMQSCSA-N |
| XLogP | 4.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|