C18H32O3Si — CID 10336398
ethyl (E)-4-[(1S,2S)-2-(3-oxopropyl)cyclopentyl]-2-(trimethylsilylmethyl)but-2-enoate (PubChem CID 10336398) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is ethyl (E)-4-[(1S,2S)-2-(3-oxopropyl)cyclopentyl]-2-(trimethylsilylmethyl)but-2-enoate.
| Compound Name | ethyl (E)-4-[(1S,2S)-2-(3-oxopropyl)cyclopentyl]-2-(trimethylsilylmethyl)but-2-enoate |
|---|---|
| PubChem CID | 10336398 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | ethyl (E)-4-[(1S,2S)-2-(3-oxopropyl)cyclopentyl]-2-(trimethylsilylmethyl)but-2-enoate |
| SMILES | CCOC(=O)/C(=C\C[C@@H]1CCC[C@H]1CCC=O)C[Si](C)(C)C |
| InChI | InChI=1S/C18H32O3Si/c1-5-21-18(20)17(14-22(2,3)4)12-11-16-9-6-8-15(16)10-7-13-19/h12-13,15-16H,5-11,14H2,1-4H3/b17-12-/t15-,16-/m0/s1 |
| InChIKey | MKAOIACVZIOEFX-XDLJQUMRSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|