C18H30O3Si — CID 101088950
tert-butyl-[[(1R,9S,10S)-8,11-dioxatricyclo[7.4.0.02,6]trideca-2(6),12-dien-10-yl]methoxy]-dimethylsilane (PubChem CID 101088950) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is tert-butyl-[[(1R,9S,10S)-8,11-dioxatricyclo[7.4.0.02,6]trideca-2(6),12-dien-10-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,9S,10S)-8,11-dioxatricyclo[7.4.0.02,6]trideca-2(6),12-dien-10-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101088950 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | tert-butyl-[[(1R,9S,10S)-8,11-dioxatricyclo[7.4.0.02,6]trideca-2(6),12-dien-10-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1OC=C[C@@H]2C3=C(CCC3)CO[C@H]12 |
| InChI | InChI=1S/C18H30O3Si/c1-18(2,3)22(4,5)21-12-16-17-15(9-10-19-16)14-8-6-7-13(14)11-20-17/h9-10,15-17H,6-8,11-12H2,1-5H3/t15-,16+,17+/m1/s1 |
| InChIKey | XZPQNFITFMHZIU-IKGGRYGDSA-N |
| XLogP | 4.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|