C20H34O4Si — CID 102317650
(1S)-1-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-cyclohexylidene-1,3-dioxolan-4-yl]but-3-yn-1-ol (PubChem CID 102317650) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (1S)-1-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-cyclohexylidene-1,3-dioxolan-4-yl]but-3-yn-1-ol.
| Compound Name | (1S)-1-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-cyclohexylidene-1,3-dioxolan-4-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 102317650 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (1S)-1-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-cyclohexylidene-1,3-dioxolan-4-yl]but-3-yn-1-ol |
| SMILES | C#CC[C@H](O)[C@H]1OC(=C2CCCCC2)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O4Si/c1-7-11-16(21)18-17(14-22-25(5,6)20(2,3)4)23-19(24-18)15-12-9-8-10-13-15/h1,16-18,21H,8-14H2,2-6H3/t16-,17-,18+/m0/s1 |
| InChIKey | AZIIJRMTKDFEST-OKZBNKHCSA-N |
| XLogP | 4.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|