C20H21FN2O3 — CID 10108920
5-[[4-(4-fluorophenyl)phenyl]-hydroxymethyl]-5-(2-methylpropyl)imidazolidine-2,4-dione (PubChem CID 10108920) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is 5-[[4-(4-fluorophenyl)phenyl]-hydroxymethyl]-5-(2-methylpropyl)imidazolidine-2,4-dione.
| Compound Name | 5-[[4-(4-fluorophenyl)phenyl]-hydroxymethyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10108920 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 5-[[4-(4-fluorophenyl)phenyl]-hydroxymethyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
| SMILES | CC(C)CC1(C(O)c2ccc(-c3ccc(F)cc3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C20H21FN2O3/c1-12(2)11-20(18(25)22-19(26)23-20)17(24)15-5-3-13(4-6-15)14-7-9-16(21)10-8-14/h3-10,12,17,24H,11H2,1-2H3,(H2,22,23,25,26) |
| InChIKey | YEKVRLFODNGEBB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|