C27H27N3O4 — CID 10139250
4-[4-[hydroxy-(4-methyl-2,5-dioxoimidazolidin-4-yl)methyl]phenyl]-N-(1-phenylpropan-2-yl)benzamide (PubChem CID 10139250) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-[4-[hydroxy-(4-methyl-2,5-dioxoimidazolidin-4-yl)methyl]phenyl]-N-(1-phenylpropan-2-yl)benzamide.
| Compound Name | 4-[4-[hydroxy-(4-methyl-2,5-dioxoimidazolidin-4-yl)methyl]phenyl]-N-(1-phenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 10139250 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-[4-[hydroxy-(4-methyl-2,5-dioxoimidazolidin-4-yl)methyl]phenyl]-N-(1-phenylpropan-2-yl)benzamide |
| SMILES | CC(Cc1ccccc1)NC(=O)c1ccc(-c2ccc(C(O)C3(C)NC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-17(16-18-6-4-3-5-7-18)28-24(32)22-14-10-20(11-15-22)19-8-12-21(13-9-19)23(31)27(2)25(33)29-26(34)30-27/h3-15,17,23,31H,16H2,1-2H3,(H,28,32)(H2,29,30,33,34) |
| InChIKey | ZOUWBLFEPFUYGE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|