C23H26N2O3 — CID 10199673
5-(cyclohexylmethyl)-5-[hydroxy-(4-phenylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 10199673) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-5-[hydroxy-(4-phenylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(cyclohexylmethyl)-5-[hydroxy-(4-phenylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10199673 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 5-(cyclohexylmethyl)-5-[hydroxy-(4-phenylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CC2CCCCC2)(C(O)c2ccc(-c3ccccc3)cc2)N1 |
| InChI | InChI=1S/C23H26N2O3/c26-20(19-13-11-18(12-14-19)17-9-5-2-6-10-17)23(21(27)24-22(28)25-23)15-16-7-3-1-4-8-16/h2,5-6,9-14,16,20,26H,1,3-4,7-8,15H2,(H2,24,25,27,28) |
| InChIKey | DEODXSSBJVZDHU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|