C20H22F2O — CID 166441435
2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol (PubChem CID 166441435) has the molecular formula C20H22F2O and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol.
| Compound Name | 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol |
|---|---|
| PubChem CID | 166441435 |
| Molecular Formula | C20H22F2O |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol |
| SMILES | OC(c1ccc(-c2ccccc2)cc1)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C20H22F2O/c21-20(22,18-9-5-2-6-10-18)19(23)17-13-11-16(12-14-17)15-7-3-1-4-8-15/h1,3-4,7-8,11-14,18-19,23H,2,5-6,9-10H2 |
| InChIKey | LHYPIHGMSABCCI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |