About 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol
2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol (PubChem CID 166441435) has the molecular formula C20H22F2O
and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol.
Molecular Properties
| Compound Name | 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol |
| PubChem CID | 166441435 |
| Molecular Formula | C20H22F2O |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol |
| SMILES | OC(c1ccc(-c2ccccc2)cc1)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C20H22F2O/c21-20(22,18-9-5-2-6-10-18)19(23)17-13-11-16(12-14-17)15-7-3-1-4-8-15/h1,3-4,7-8,11-14,18-19,23H,2,5-6,9-10H2 |
| InChIKey | LHYPIHGMSABCCI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol?
The IUPAC name of 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol (CID 166441435) is 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol.
What is the SMILES notation for 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol?
The canonical SMILES for 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol is OC(c1ccc(-c2ccccc2)cc1)C(F)(F)C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol?
The InChIKey is LHYPIHGMSABCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2O/c21-20(22,18-9-5-2-6-10-18)19(23)17-13-11-16(12-14-17)15-7-3-1-4-8-15/h1,3-4,7-8,11-14,18-19,23H,2,5-6,9-10H2.
What are the key properties of 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol?
2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol has a molecular weight of 316.39 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2,2-difluoro-1-(4-phenylphenyl)ethanol is sourced from PubChem (CID 166441435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).