C8H14N2O2 — CID 51382710
(5R)-5-ethyl-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 51382710) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (5R)-5-ethyl-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51382710 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (5R)-5-ethyl-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC[C@]1(C(C)C)NC(=O)NC1=O |
| InChI | InChI=1S/C8H14N2O2/c1-4-8(5(2)3)6(11)9-7(12)10-8/h5H,4H2,1-3H3,(H2,9,10,11,12)/t8-/m1/s1 |
| InChIKey | OWPKRUBICRFJHU-MRVPVSSYSA-N |
| XLogP | 0.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|