C23H32N2O2 — CID 101090835
3-ethyl-5-methoxy-N-[3-methyl-2-[(Z)-pent-2-enyl]cyclopentyl]-1H-indole-2-carboxamide (PubChem CID 101090835) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-ethyl-5-methoxy-N-[3-methyl-2-[(Z)-pent-2-enyl]cyclopentyl]-1H-indole-2-carboxamide.
| Compound Name | 3-ethyl-5-methoxy-N-[3-methyl-2-[(Z)-pent-2-enyl]cyclopentyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 101090835 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 3-ethyl-5-methoxy-N-[3-methyl-2-[(Z)-pent-2-enyl]cyclopentyl]-1H-indole-2-carboxamide |
| SMILES | CC/C=C\CC1C(C)CCC1NC(=O)c1[nH]c2ccc(OC)cc2c1CC |
| InChI | InChI=1S/C23H32N2O2/c1-5-7-8-9-18-15(3)10-12-20(18)25-23(26)22-17(6-2)19-14-16(27-4)11-13-21(19)24-22/h7-8,11,13-15,18,20,24H,5-6,9-10,12H2,1-4H3,(H,25,26)/b8-7- |
| InChIKey | CNBPJJGTUVHSIN-FPLPWBNLSA-N |
| XLogP | 5.24 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|