C26H38Si2 — CID 101091349
[(2S)-butan-2-yl]-[4-[2-[4-[[(2S)-butan-2-yl]-dimethylsilyl]phenyl]ethynyl]phenyl]-dimethylsilane (PubChem CID 101091349) has the molecular formula C26H38Si2 and a molecular weight of 406.76 g/mol. Its IUPAC name is [(2S)-butan-2-yl]-[4-[2-[4-[[(2S)-butan-2-yl]-dimethylsilyl]phenyl]ethynyl]phenyl]-dimethylsilane.
| Compound Name | [(2S)-butan-2-yl]-[4-[2-[4-[[(2S)-butan-2-yl]-dimethylsilyl]phenyl]ethynyl]phenyl]-dimethylsilane |
|---|---|
| PubChem CID | 101091349 |
| Molecular Formula | C26H38Si2 |
| Molecular Weight | 406.76 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | [(2S)-butan-2-yl]-[4-[2-[4-[[(2S)-butan-2-yl]-dimethylsilyl]phenyl]ethynyl]phenyl]-dimethylsilane |
| SMILES | CC[C@H](C)[Si](C)(C)c1ccc(C#Cc2ccc([Si](C)(C)[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C26H38Si2/c1-9-21(3)27(5,6)25-17-13-23(14-18-25)11-12-24-15-19-26(20-16-24)28(7,8)22(4)10-2/h13-22H,9-10H2,1-8H3/t21-,22-/m0/s1 |
| InChIKey | LYCOTEMTQSTUDN-VXKWHMMOSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|