C11H9Cl3 — CID 101094176
[(1S,2R)-2-(1,2,2-trichloroethenyl)cyclopropyl]benzene (PubChem CID 101094176) has the molecular formula C11H9Cl3 and a molecular weight of 247.55 g/mol. Its IUPAC name is [(1S,2R)-2-(1,2,2-trichloroethenyl)cyclopropyl]benzene.
| Compound Name | [(1S,2R)-2-(1,2,2-trichloroethenyl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 101094176 |
| Molecular Formula | C11H9Cl3 |
| Molecular Weight | 247.55 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | [(1S,2R)-2-(1,2,2-trichloroethenyl)cyclopropyl]benzene |
| SMILES | ClC(Cl)=C(Cl)[C@@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H9Cl3/c12-10(11(13)14)9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6H2/t8-,9-/m1/s1 |
| InChIKey | XTUWWQHIFXVSGC-RKDXNWHRSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |