C11H10Cl2 — CID 134996323
[(1R,2S)-2-[(Z)-1,2-dichloroethenyl]cyclopropyl]benzene (PubChem CID 134996323) has the molecular formula C11H10Cl2 and a molecular weight of 213.11 g/mol. Its IUPAC name is [(1R,2S)-2-[(Z)-1,2-dichloroethenyl]cyclopropyl]benzene.
| Compound Name | [(1R,2S)-2-[(Z)-1,2-dichloroethenyl]cyclopropyl]benzene |
|---|---|
| PubChem CID | 134996323 |
| Molecular Formula | C11H10Cl2 |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | [(1R,2S)-2-[(Z)-1,2-dichloroethenyl]cyclopropyl]benzene |
| SMILES | Cl/C=C(\Cl)[C@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H10Cl2/c12-7-11(13)10-6-9(10)8-4-2-1-3-5-8/h1-5,7,9-10H,6H2/b11-7-/t9-,10-/m0/s1 |
| InChIKey | MSFXARRZWJGQPS-VLFDAMPASA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |