C24H27N3O6 — CID 101096586
[(4aR,6S,7S,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-6-prop-2-enoxy-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl]methanol (PubChem CID 101096586) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is [(4aR,6S,7S,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-6-prop-2-enoxy-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl]methanol.
| Compound Name | [(4aR,6S,7S,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-6-prop-2-enoxy-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl]methanol |
|---|---|
| PubChem CID | 101096586 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | [(4aR,6S,7S,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-6-prop-2-enoxy-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl]methanol |
| SMILES | C=CCO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@]1(CO)N=[N+]=[N-] |
| InChI | InChI=1S/C24H27N3O6/c1-2-13-29-23-24(16-28,26-27-25)21(30-14-17-9-5-3-6-10-17)20-19(32-23)15-31-22(33-20)18-11-7-4-8-12-18/h2-12,19-23,28H,1,13-16H2/t19-,20-,21+,22?,23+,24+/m1/s1 |
| InChIKey | GMALVANHDQRJBN-WMNVRLJGSA-N |
| XLogP | 3.65 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|