C25H30O7 — CID 101345633
(2R,4aR,6S,7S,8S,8aR)-6-methoxy-8-[(4-methoxyphenyl)methoxy]-2-phenyl-7-prop-2-enyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 101345633) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8S,8aR)-6-methoxy-8-[(4-methoxyphenyl)methoxy]-2-phenyl-7-prop-2-enyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (2R,4aR,6S,7S,8S,8aR)-6-methoxy-8-[(4-methoxyphenyl)methoxy]-2-phenyl-7-prop-2-enyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 101345633 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (2R,4aR,6S,7S,8S,8aR)-6-methoxy-8-[(4-methoxyphenyl)methoxy]-2-phenyl-7-prop-2-enyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | C=CC[C@@]1(O)[C@@H](OC)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H30O7/c1-4-14-25(26)22(29-15-17-10-12-19(27-2)13-11-17)21-20(31-24(25)28-3)16-30-23(32-21)18-8-6-5-7-9-18/h4-13,20-24,26H,1,14-16H2,2-3H3/t20-,21-,22+,23-,24+,25+/m1/s1 |
| InChIKey | KOTLDPRBKJDVLM-RIQJQHKOSA-N |
| XLogP | 3.37 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|