C19H15ClO4 — CID 101098502
(1R,3aS,8bR)-7-(4-chlorophenyl)-3a-methyl-2-oxo-4,8b-dihydro-1H-indeno[2,1-b]furan-1-carboxylic acid (PubChem CID 101098502) has the molecular formula C19H15ClO4 and a molecular weight of 342.78 g/mol. Its IUPAC name is (1R,3aS,8bR)-7-(4-chlorophenyl)-3a-methyl-2-oxo-4,8b-dihydro-1H-indeno[2,1-b]furan-1-carboxylic acid.
| Compound Name | (1R,3aS,8bR)-7-(4-chlorophenyl)-3a-methyl-2-oxo-4,8b-dihydro-1H-indeno[2,1-b]furan-1-carboxylic acid |
|---|---|
| PubChem CID | 101098502 |
| Molecular Formula | C19H15ClO4 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (1R,3aS,8bR)-7-(4-chlorophenyl)-3a-methyl-2-oxo-4,8b-dihydro-1H-indeno[2,1-b]furan-1-carboxylic acid |
| SMILES | C[C@]12Cc3ccc(-c4ccc(Cl)cc4)cc3[C@H]1[C@H](C(=O)O)C(=O)O2 |
| InChI | InChI=1S/C19H15ClO4/c1-19-9-12-3-2-11(10-4-6-13(20)7-5-10)8-14(12)16(19)15(17(21)22)18(23)24-19/h2-8,15-16H,9H2,1H3,(H,21,22)/t15-,16+,19+/m1/s1 |
| InChIKey | FWQAUDJSJGPSQD-GJYPPUQNSA-N |
| XLogP | 3.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|