C16H11ClO3S — CID 10615551
6-(4-chlorophenyl)-4-oxo-1H-isothiochromene-1-carboxylic acid (PubChem CID 10615551) has the molecular formula C16H11ClO3S and a molecular weight of 318.78 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4-oxo-1H-isothiochromene-1-carboxylic acid.
| Compound Name | 6-(4-chlorophenyl)-4-oxo-1H-isothiochromene-1-carboxylic acid |
|---|---|
| PubChem CID | 10615551 |
| Molecular Formula | C16H11ClO3S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 6-(4-chlorophenyl)-4-oxo-1H-isothiochromene-1-carboxylic acid |
| SMILES | O=C1CSC(C(=O)O)c2ccc(-c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C16H11ClO3S/c17-11-4-1-9(2-5-11)10-3-6-12-13(7-10)14(18)8-21-15(12)16(19)20/h1-7,15H,8H2,(H,19,20) |
| InChIKey | SOSCCCWCEUKOBR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |