C17H14ClNO2S — CID 57137379
N-(4-chlorophenyl)-5-oxo-1,2-dihydro-3-benzothiepine-2-carboxamide (PubChem CID 57137379) has the molecular formula C17H14ClNO2S and a molecular weight of 331.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-oxo-1,2-dihydro-3-benzothiepine-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)-5-oxo-1,2-dihydro-3-benzothiepine-2-carboxamide |
|---|---|
| PubChem CID | 57137379 |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-(4-chlorophenyl)-5-oxo-1,2-dihydro-3-benzothiepine-2-carboxamide |
| SMILES | O=C1CSC(C(=O)Nc2ccc(Cl)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C17H14ClNO2S/c18-12-5-7-13(8-6-12)19-17(21)16-9-11-3-1-2-4-14(11)15(20)10-22-16/h1-8,16H,9-10H2,(H,19,21) |
| InChIKey | DPILOJJWPHBADS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |