methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate

C12H12O3S — CID 10633555

IUPACmethyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate
SMILESCOC(=O)C1Cc2ccccc2C(=O)CS1
InChIInChI=1S/C12H12O3S/c1-15-12(14)11-6-8-4-2-3-5-9(8)10(13)7-16-11/h2-5,11H,6-7H2,1H3
InChIKeyGTJSDMAOFUOGRT-UHFFFAOYSA-N
MW236.29 g/mol
LogP1.70
Rot. Bonds1

About methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate

methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate (PubChem CID 10633555) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate
PubChem CID10633555
Molecular FormulaC12H12O3S
Molecular Weight236.29 g/mol
Exact Mass236.05
IUPAC Namemethyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate
SMILESCOC(=O)C1Cc2ccccc2C(=O)CS1
InChIInChI=1S/C12H12O3S/c1-15-12(14)11-6-8-4-2-3-5-9(8)10(13)7-16-11/h2-5,11H,6-7H2,1H3
InChIKeyGTJSDMAOFUOGRT-UHFFFAOYSA-N
XLogP1.70
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.29
LogP ≤ 51.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate?
The IUPAC name of methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate (CID 10633555) is methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate.
What is the SMILES notation for methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate?
The canonical SMILES for methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate is COC(=O)C1Cc2ccccc2C(=O)CS1.
What is the InChIKey of methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate?
The InChIKey is GTJSDMAOFUOGRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3S/c1-15-12(14)11-6-8-4-2-3-5-9(8)10(13)7-16-11/h2-5,11H,6-7H2,1H3.
What are the key properties of methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate?
methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate has a molecular weight of 236.29 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate is sourced from PubChem (CID 10633555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).