C12H12O3S — CID 10633555
methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate (PubChem CID 10633555) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate.
| Compound Name | methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate |
|---|---|
| PubChem CID | 10633555 |
| Molecular Formula | C12H12O3S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | methyl 5-oxo-1,2-dihydro-3-benzothiepine-2-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2C(=O)CS1 |
| InChI | InChI=1S/C12H12O3S/c1-15-12(14)11-6-8-4-2-3-5-9(8)10(13)7-16-11/h2-5,11H,6-7H2,1H3 |
| InChIKey | GTJSDMAOFUOGRT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |