C14H17NOS — CID 13308369
4,5-dimethyl-N-phenyl-3,6-dihydro-2H-thiopyran-2-carboxamide (PubChem CID 13308369) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is 4,5-dimethyl-N-phenyl-3,6-dihydro-2H-thiopyran-2-carboxamide.
| Compound Name | 4,5-dimethyl-N-phenyl-3,6-dihydro-2H-thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 13308369 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4,5-dimethyl-N-phenyl-3,6-dihydro-2H-thiopyran-2-carboxamide |
| SMILES | CC1=C(C)CC(C(=O)Nc2ccccc2)SC1 |
| InChI | InChI=1S/C14H17NOS/c1-10-8-13(17-9-11(10)2)14(16)15-12-6-4-3-5-7-12/h3-7,13H,8-9H2,1-2H3,(H,15,16) |
| InChIKey | OHADKYVRGRMUFR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|